Carboxylic acids and derivatives
Filtered Search Results
Ethyl caproate, 99+%
CAS: 123-66-0 Molecular Formula: C8H16O2 Molecular Weight (g/mol): 144.21 MDL Number: MFCD00009511 InChI Key: SHZIWNPUGXLXDT-UHFFFAOYSA-N Synonym: ethyl caproate,ethyl hexoate,hexanoic acid, ethyl ester,hexanoic acid ethyl ester,capronic ether absolute,caproic acid ethyl ester,ethyl n-hexanoate,ethyl butyl acetate,caproate,acetic acid, butyl-, ethyl ester PubChem CID: 31265 ChEBI: CHEBI:86055 IUPAC Name: ethyl hexanoate SMILES: CCCCCC(=O)OCC
| PubChem CID | 31265 |
|---|---|
| CAS | 123-66-0 |
| Molecular Weight (g/mol) | 144.21 |
| ChEBI | CHEBI:86055 |
| MDL Number | MFCD00009511 |
| SMILES | CCCCCC(=O)OCC |
| Synonym | ethyl caproate,ethyl hexoate,hexanoic acid, ethyl ester,hexanoic acid ethyl ester,capronic ether absolute,caproic acid ethyl ester,ethyl n-hexanoate,ethyl butyl acetate,caproate,acetic acid, butyl-, ethyl ester |
| IUPAC Name | ethyl hexanoate |
| InChI Key | SHZIWNPUGXLXDT-UHFFFAOYSA-N |
| Molecular Formula | C8H16O2 |
Methyl oxalyl chloride, 97%
CAS: 5781-53-3 Molecular Formula: C3H3ClO3 Molecular Weight (g/mol): 122.51 MDL Number: MFCD00000705 InChI Key: ZXUQEPZWVQIOJE-UHFFFAOYSA-N Synonym: methyl oxalyl chloride,methyl chloroglyoxylate,methyl chlorooxoacetate,chloroglyoxylic acid methyl ester,acetic acid, chlorooxo-, methyl ester,methyl chlorocarbonyl formate,methyloxalylchloride,methyl chloro oxo acetate,methylchlorooxoacetate,methyl 2-chloro-2-oxo-acetate PubChem CID: 79846 IUPAC Name: methyl 2-chloro-2-oxoacetate SMILES: COC(=O)C(=O)Cl
| PubChem CID | 79846 |
|---|---|
| CAS | 5781-53-3 |
| Molecular Weight (g/mol) | 122.51 |
| MDL Number | MFCD00000705 |
| SMILES | COC(=O)C(=O)Cl |
| Synonym | methyl oxalyl chloride,methyl chloroglyoxylate,methyl chlorooxoacetate,chloroglyoxylic acid methyl ester,acetic acid, chlorooxo-, methyl ester,methyl chlorocarbonyl formate,methyloxalylchloride,methyl chloro oxo acetate,methylchlorooxoacetate,methyl 2-chloro-2-oxo-acetate |
| IUPAC Name | methyl 2-chloro-2-oxoacetate |
| InChI Key | ZXUQEPZWVQIOJE-UHFFFAOYSA-N |
| Molecular Formula | C3H3ClO3 |
1-Cyclohexene-1-carboxylic acid, 96%
CAS: 636-82-8 Molecular Formula: C7H10O2 Molecular Weight (g/mol): 126.16 MDL Number: MFCD00001545 InChI Key: NMEZJSDUZQOPFE-UHFFFAOYSA-N Synonym: 1-cyclohexene-1-carboxylic acid,1-cyclohexenecarboxylic acid,cyclohex-1-enecarboxylic acid,cyclohexenecarboxylic acid,cyclohex-1-ene-1-carboxylic acid,1-cyclohexenecarboxylicacid,cyclohexenyl carboxylic acid,1-cyclohexene carboxylic acid,acmc-1b731,3,4,5,6-tetrahydrobenzoic acid PubChem CID: 69470 ChEBI: CHEBI:29565 IUPAC Name: cyclohexene-1-carboxylic acid SMILES: C1CCC(=CC1)C(=O)O
| PubChem CID | 69470 |
|---|---|
| CAS | 636-82-8 |
| Molecular Weight (g/mol) | 126.16 |
| ChEBI | CHEBI:29565 |
| MDL Number | MFCD00001545 |
| SMILES | C1CCC(=CC1)C(=O)O |
| Synonym | 1-cyclohexene-1-carboxylic acid,1-cyclohexenecarboxylic acid,cyclohex-1-enecarboxylic acid,cyclohexenecarboxylic acid,cyclohex-1-ene-1-carboxylic acid,1-cyclohexenecarboxylicacid,cyclohexenyl carboxylic acid,1-cyclohexene carboxylic acid,acmc-1b731,3,4,5,6-tetrahydrobenzoic acid |
| IUPAC Name | cyclohexene-1-carboxylic acid |
| InChI Key | NMEZJSDUZQOPFE-UHFFFAOYSA-N |
| Molecular Formula | C7H10O2 |
4-Methylvaleric acid, 99%
CAS: 646-07-1 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.15 MDL Number: MFCD00002803 InChI Key: FGKJLKRYENPLQH-UHFFFAOYSA-N Synonym: 4-methylvaleric acid,isocaproic acid,isohexanoic acid,pentanoic acid, 4-methyl,isobutylacetic acid,4-methyl-pentanoic acid,valeric acid, 4-methyl,4-methyl valeric acid,isocaproate,4,4-dimethylbutanoic acid PubChem CID: 12587 ChEBI: CHEBI:74903 IUPAC Name: 4-methylpentanoic acid SMILES: CC(C)CCC(=O)O
| PubChem CID | 12587 |
|---|---|
| CAS | 646-07-1 |
| Molecular Weight (g/mol) | 116.15 |
| ChEBI | CHEBI:74903 |
| MDL Number | MFCD00002803 |
| SMILES | CC(C)CCC(=O)O |
| Synonym | 4-methylvaleric acid,isocaproic acid,isohexanoic acid,pentanoic acid, 4-methyl,isobutylacetic acid,4-methyl-pentanoic acid,valeric acid, 4-methyl,4-methyl valeric acid,isocaproate,4,4-dimethylbutanoic acid |
| IUPAC Name | 4-methylpentanoic acid |
| InChI Key | FGKJLKRYENPLQH-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
3-Mercaptopropionic acid, 98%
CAS: 107-96-0 Molecular Formula: C3H6O2S Molecular Weight (g/mol): 106.14 MDL Number: MFCD00004897 InChI Key: DKIDEFUBRARXTE-UHFFFAOYSA-N Synonym: 3-mercaptopropionic acid,3-mercaptopropanoic acid,3-thiopropionic acid,3-thiopropanoic acid,propanoic acid, 3-mercapto,beta-mercaptopropionic acid,3mpa,mercaptopropionic acid,beta-thiopropionic acid,2-mercaptoethanecarboxylic acid PubChem CID: 6514 ChEBI: CHEBI:44111 IUPAC Name: 3-sulfanylpropanoic acid SMILES: C(CS)C(=O)O
| PubChem CID | 6514 |
|---|---|
| CAS | 107-96-0 |
| Molecular Weight (g/mol) | 106.14 |
| ChEBI | CHEBI:44111 |
| MDL Number | MFCD00004897 |
| SMILES | C(CS)C(=O)O |
| Synonym | 3-mercaptopropionic acid,3-mercaptopropanoic acid,3-thiopropionic acid,3-thiopropanoic acid,propanoic acid, 3-mercapto,beta-mercaptopropionic acid,3mpa,mercaptopropionic acid,beta-thiopropionic acid,2-mercaptoethanecarboxylic acid |
| IUPAC Name | 3-sulfanylpropanoic acid |
| InChI Key | DKIDEFUBRARXTE-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2S |
4-Amino-5-imidazolecarboxamide hydrochloride, 98%
CAS: 72-40-2 Molecular Formula: C4H7ClN4O Molecular Weight (g/mol): 162.58 MDL Number: MFCD00012704 InChI Key: MXCUYSMIELHIQL-UHFFFAOYSA-N Synonym: 4-amino-5-imidazolecarboxamide hydrochloride,5-amino-4-imidazolecarboxamide hydrochloride,5-amino-1h-imidazole-4-carboxamide hydrochloride,5-aminoimidazole-4-carboxamide hydrochloride,aic .cntdot. hcl,4-amino-1h-imidazole-5-carboxamide hydrochloride,aminoimidazolecarboxamide hydrochloride,4-aminoimidazole-5-carboxamide hydrochloride,1h-imidazole-4-carboxamide, 5-amino-, monohydrochloride,5-aminoimidazol-4-carboxamide, hydrochloride PubChem CID: 66146 IUPAC Name: 4-amino-1H-imidazole-5-carboxamide;hydrochloride SMILES: Cl.NC(=O)C1=C(N)N=CN1
| PubChem CID | 66146 |
|---|---|
| CAS | 72-40-2 |
| Molecular Weight (g/mol) | 162.58 |
| MDL Number | MFCD00012704 |
| SMILES | Cl.NC(=O)C1=C(N)N=CN1 |
| Synonym | 4-amino-5-imidazolecarboxamide hydrochloride,5-amino-4-imidazolecarboxamide hydrochloride,5-amino-1h-imidazole-4-carboxamide hydrochloride,5-aminoimidazole-4-carboxamide hydrochloride,aic .cntdot. hcl,4-amino-1h-imidazole-5-carboxamide hydrochloride,aminoimidazolecarboxamide hydrochloride,4-aminoimidazole-5-carboxamide hydrochloride,1h-imidazole-4-carboxamide, 5-amino-, monohydrochloride,5-aminoimidazol-4-carboxamide, hydrochloride |
| IUPAC Name | 4-amino-1H-imidazole-5-carboxamide;hydrochloride |
| InChI Key | MXCUYSMIELHIQL-UHFFFAOYSA-N |
| Molecular Formula | C4H7ClN4O |
Methyl (S)-(-)-lactate, 97%
CAS: 27871-49-4 Molecular Formula: C4H8O3 Molecular Weight (g/mol): 104.11 MDL Number: MFCD00064265 InChI Key: LPEKGGXMPWTOCB-VKHMYHEASA-N Synonym: methyl s---lactate,methyl l-lactate,s-methyl lactate,--methyl l-lactate,s-lactic acid methyl ester,methyl 2s-2-hydroxypropanoate,--methyl lactate,methyl s-2-hydroxypropionate,propanoic acid, 2-hydroxy-, methyl ester, 2s,--lactic acid methyl ester PubChem CID: 94386 ChEBI: CHEBI:83222 IUPAC Name: methyl (2S)-2-hydroxypropanoate SMILES: COC(=O)[C@H](C)O
| PubChem CID | 94386 |
|---|---|
| CAS | 27871-49-4 |
| Molecular Weight (g/mol) | 104.11 |
| ChEBI | CHEBI:83222 |
| MDL Number | MFCD00064265 |
| SMILES | COC(=O)[C@H](C)O |
| Synonym | methyl s---lactate,methyl l-lactate,s-methyl lactate,--methyl l-lactate,s-lactic acid methyl ester,methyl 2s-2-hydroxypropanoate,--methyl lactate,methyl s-2-hydroxypropionate,propanoic acid, 2-hydroxy-, methyl ester, 2s,--lactic acid methyl ester |
| IUPAC Name | methyl (2S)-2-hydroxypropanoate |
| InChI Key | LPEKGGXMPWTOCB-VKHMYHEASA-N |
| Molecular Formula | C4H8O3 |
Ethyl trimethylacetate, 99%
CAS: 3938-95-2 Molecular Formula: C7H14O2 Molecular Weight (g/mol): 130.187 MDL Number: MFCD00009129 InChI Key: HHEIMYAXCOIQCJ-UHFFFAOYSA-N Synonym: ethyl trimethylacetate,ethyl pivalate,propanoic acid, 2,2-dimethyl-, ethyl ester,ethyl 2,2-dimethylpropionate,pivalic acid, ethyl ester,ethylpivalate,trimethylacetic acid, ethyl ester,unii-738s62lzwy,ethyltrimethylacetate,2,2-dimethylpropanoic acid ethyl ester PubChem CID: 19838 IUPAC Name: ethyl 2,2-dimethylpropanoate SMILES: CCOC(=O)C(C)(C)C
| PubChem CID | 19838 |
|---|---|
| CAS | 3938-95-2 |
| Molecular Weight (g/mol) | 130.187 |
| MDL Number | MFCD00009129 |
| SMILES | CCOC(=O)C(C)(C)C |
| Synonym | ethyl trimethylacetate,ethyl pivalate,propanoic acid, 2,2-dimethyl-, ethyl ester,ethyl 2,2-dimethylpropionate,pivalic acid, ethyl ester,ethylpivalate,trimethylacetic acid, ethyl ester,unii-738s62lzwy,ethyltrimethylacetate,2,2-dimethylpropanoic acid ethyl ester |
| IUPAC Name | ethyl 2,2-dimethylpropanoate |
| InChI Key | HHEIMYAXCOIQCJ-UHFFFAOYSA-N |
| Molecular Formula | C7H14O2 |
Edetate Disodium, USP, EP, JP, bioCERTIFIED™, 1 kg, Spectrum Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
1-Acetamidoadamantane, 98%
CAS: 880-52-4 Molecular Formula: C12H19NO Molecular Weight (g/mol): 193.29 MDL Number: MFCD00074730 InChI Key: BCVXYGJCDZPKGV-UHFFFAOYSA-N Synonym: 1-acetamidoadamantane,n-1-adamantyl acetamide,n-adamantan-1-yl acetamide,1-acetylaminoadamantane,1-adamantylacetamide,acetamide, n-1-adamantyl,n-adamantylacetamide,1-acetamino adamantane,unii-5283y1voii,n-acetyl adamantamine PubChem CID: 64153 IUPAC Name: N-(1-adamantyl)acetamide SMILES: CC(=O)NC12CC3CC(C1)CC(C3)C2
| PubChem CID | 64153 |
|---|---|
| CAS | 880-52-4 |
| Molecular Weight (g/mol) | 193.29 |
| MDL Number | MFCD00074730 |
| SMILES | CC(=O)NC12CC3CC(C1)CC(C3)C2 |
| Synonym | 1-acetamidoadamantane,n-1-adamantyl acetamide,n-adamantan-1-yl acetamide,1-acetylaminoadamantane,1-adamantylacetamide,acetamide, n-1-adamantyl,n-adamantylacetamide,1-acetamino adamantane,unii-5283y1voii,n-acetyl adamantamine |
| IUPAC Name | N-(1-adamantyl)acetamide |
| InChI Key | BCVXYGJCDZPKGV-UHFFFAOYSA-N |
| Molecular Formula | C12H19NO |
Ethyl propiolate, 99%
CAS: 623-47-2 Molecular Formula: C5H6O2 Molecular Weight (g/mol): 98.10 MDL Number: MFCD00009184 InChI Key: FMVJYQGSRWVMQV-UHFFFAOYSA-N Synonym: ethyl propiolate,ethyl acetylenecarboxylate,2-propynoic acid, ethyl ester,propiolic acid ethyl ester,ethyl propynoate,ethoxycarbonyl acetylene,ethyl 2-propynoate,propiolic acid, ethyl ester,unii-w235g5u52s,propynoic acid ethyl ester PubChem CID: 12182 ChEBI: CHEBI:51740 IUPAC Name: ethyl prop-2-ynoate SMILES: CCOC(=O)C#C
| PubChem CID | 12182 |
|---|---|
| CAS | 623-47-2 |
| Molecular Weight (g/mol) | 98.10 |
| ChEBI | CHEBI:51740 |
| MDL Number | MFCD00009184 |
| SMILES | CCOC(=O)C#C |
| Synonym | ethyl propiolate,ethyl acetylenecarboxylate,2-propynoic acid, ethyl ester,propiolic acid ethyl ester,ethyl propynoate,ethoxycarbonyl acetylene,ethyl 2-propynoate,propiolic acid, ethyl ester,unii-w235g5u52s,propynoic acid ethyl ester |
| IUPAC Name | ethyl prop-2-ynoate |
| InChI Key | FMVJYQGSRWVMQV-UHFFFAOYSA-N |
| Molecular Formula | C5H6O2 |
Diethyl fumarate, 98%
CAS: 623-91-6 Molecular Formula: C8H12O4 Molecular Weight (g/mol): 172.18 MDL Number: MFCD00064455 InChI Key: IEPRKVQEAMIZSS-AATRIKPKSA-N Synonym: diethyl fumarate,fumaric acid, diethyl ester,anti-psoriaticum,diethyl 2e-but-2-enedioate,fumaric acid diethyl ester,diethyl e-but-2-enedioate,2-butenedioic acid e-, diethyl ester,trans-2-butenedioic acid diethyl ester,2-butenedioic acid 2e-, diethyl ester,unii-5wbu5a3e8a PubChem CID: 638144 ChEBI: CHEBI:87388 IUPAC Name: diethyl (E)-but-2-enedioate SMILES: CCOC(=O)\C=C\C(=O)OCC
| PubChem CID | 638144 |
|---|---|
| CAS | 623-91-6 |
| Molecular Weight (g/mol) | 172.18 |
| ChEBI | CHEBI:87388 |
| MDL Number | MFCD00064455 |
| SMILES | CCOC(=O)\C=C\C(=O)OCC |
| Synonym | diethyl fumarate,fumaric acid, diethyl ester,anti-psoriaticum,diethyl 2e-but-2-enedioate,fumaric acid diethyl ester,diethyl e-but-2-enedioate,2-butenedioic acid e-, diethyl ester,trans-2-butenedioic acid diethyl ester,2-butenedioic acid 2e-, diethyl ester,unii-5wbu5a3e8a |
| IUPAC Name | diethyl (E)-but-2-enedioate |
| InChI Key | IEPRKVQEAMIZSS-AATRIKPKSA-N |
| Molecular Formula | C8H12O4 |
N-Methylformanilide, 99%
CAS: 93-61-8 MDL Number: MFCD00003283 InChI Key: JIKUXBYRTXDNIY-UHFFFAOYSA-N Synonym: n-methylformanilide,formamide, n-methyl-n-phenyl,n-formyl-n-methylaniline,formanilide, n-methyl,methylphenylformamide,n-phenyl-n-methylformamide,n-methyl-n-formylaniline,n-methylformanilid,methyl phenyl formamide,n-methyl-n-phenyl-formamide PubChem CID: 66737 IUPAC Name: N-methyl-N-phenylformamide SMILES: CN(C=O)C1=CC=CC=C1
| PubChem CID | 66737 |
|---|---|
| CAS | 93-61-8 |
| MDL Number | MFCD00003283 |
| SMILES | CN(C=O)C1=CC=CC=C1 |
| Synonym | n-methylformanilide,formamide, n-methyl-n-phenyl,n-formyl-n-methylaniline,formanilide, n-methyl,methylphenylformamide,n-phenyl-n-methylformamide,n-methyl-n-formylaniline,n-methylformanilid,methyl phenyl formamide,n-methyl-n-phenyl-formamide |
| IUPAC Name | N-methyl-N-phenylformamide |
| InChI Key | JIKUXBYRTXDNIY-UHFFFAOYSA-N |
Edetate Disodium, Dihydrate, BiotechGrade, 99-101%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L IUPAC Name: disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| CAS | 6381-92-6 |
|---|---|
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| IUPAC Name | disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
MilliporeSigma™ EDTA, OmniPur™, Calbiochem™,
CAS: 60-00-4 Molecular Formula: C10H16N2O8 Molecular Weight (g/mol): 292.24 MDL Number: MFCD00003541 InChI Key: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC Name: 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 6049 |
|---|---|
| CAS | 60-00-4 |
| Molecular Weight (g/mol) | 292.24 |
| ChEBI | CHEBI:42191 |
| MDL Number | MFCD00003541 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| IUPAC Name | 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O8 |